C13H16N4O5 — CID 5234134
3-[(2-methoxy-5-nitroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 5234134) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 3-[(2-methoxy-5-nitroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-methoxy-5-nitroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5234134 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-[(2-methoxy-5-nitroanilino)methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccc([N+](=O)[O-])cc1NCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C13H16N4O5/c1-13(2)11(18)16(12(19)15-13)7-14-9-6-8(17(20)21)4-5-10(9)22-3/h4-6,14H,7H2,1-3H3,(H,15,19) |
| InChIKey | YXHPXIMHIYWOSI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|