C16H20ClFN4S2 — CID 143507495
N-but-3-en-2-ylsulfanyl-1-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 143507495) has the molecular formula C16H20ClFN4S2 and a molecular weight of 386.95 g/mol. Its IUPAC name is N-but-3-en-2-ylsulfanyl-1-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | N-but-3-en-2-ylsulfanyl-1-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 143507495 |
| Molecular Formula | C16H20ClFN4S2 |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-but-3-en-2-ylsulfanyl-1-[5-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | C=CC(C)SNCc1nnc(SCc2c(F)cccc2Cl)n1CC |
| InChI | InChI=1S/C16H20ClFN4S2/c1-4-11(3)24-19-9-15-20-21-16(22(15)5-2)23-10-12-13(17)7-6-8-14(12)18/h4,6-8,11,19H,1,5,9-10H2,2-3H3 |
| InChIKey | AAIKBOBRBBZQDX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|