C21H25Cl3N2S — CID 143508395
1-[1-(4-chlorophenyl)-6-(2,4-dichlorophenyl)piperidin-3-yl]-N-propylsulfanylmethanamine (PubChem CID 143508395) has the molecular formula C21H25Cl3N2S and a molecular weight of 443.87 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-6-(2,4-dichlorophenyl)piperidin-3-yl]-N-propylsulfanylmethanamine.
| Compound Name | 1-[1-(4-chlorophenyl)-6-(2,4-dichlorophenyl)piperidin-3-yl]-N-propylsulfanylmethanamine |
|---|---|
| PubChem CID | 143508395 |
| Molecular Formula | C21H25Cl3N2S |
| Molecular Weight | 443.87 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-6-(2,4-dichlorophenyl)piperidin-3-yl]-N-propylsulfanylmethanamine |
| SMILES | CCCSNCC1CCC(c2ccc(Cl)cc2Cl)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H25Cl3N2S/c1-2-11-27-25-13-15-3-10-21(19-9-6-17(23)12-20(19)24)26(14-15)18-7-4-16(22)5-8-18/h4-9,12,15,21,25H,2-3,10-11,13-14H2,1H3 |
| InChIKey | ALYULVSSCVTIKV-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.87 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|