C19H20Cl3NO — CID 59435462
4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-propylmorpholine (PubChem CID 59435462) has the molecular formula C19H20Cl3NO and a molecular weight of 384.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-propylmorpholine.
| Compound Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-propylmorpholine |
|---|---|
| PubChem CID | 59435462 |
| Molecular Formula | C19H20Cl3NO |
| Molecular Weight | 384.73 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-2-propylmorpholine |
| SMILES | CCCC1CN(c2ccc(Cl)cc2)C(c2ccc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C19H20Cl3NO/c1-2-3-16-11-23(15-7-4-13(20)5-8-15)19(12-24-16)17-9-6-14(21)10-18(17)22/h4-10,16,19H,2-3,11-12H2,1H3 |
| InChIKey | AOKABELSSIWGMH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.73 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |