About 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine (PubChem CID 143508383) has the molecular formula C23H29Cl3N2
and a molecular weight of 439.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine |
| PubChem CID | 143508383 |
| Molecular Formula | C23H29Cl3N2 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine |
| SMILES | CN1CCCCC1.Clc1ccc(N2CCCCC2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H16Cl3N.C6H13N/c18-12-4-7-14(8-5-12)21-10-2-1-3-17(21)15-9-6-13(19)11-16(15)20;1-7-5-3-2-4-6-7/h4-9,11,17H,1-3,10H2;2-6H2,1H3 |
| InChIKey | FSDVTJOXJGETIN-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine?
The IUPAC name of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine (CID 143508383) is 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine.
What is the SMILES notation for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine?
The canonical SMILES for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine is CN1CCCCC1.Clc1ccc(N2CCCCC2c2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine?
The InChIKey is FSDVTJOXJGETIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl3N.C6H13N/c18-12-4-7-14(8-5-12)21-10-2-1-3-17(21)15-9-6-13(19)11-16(15)20;1-7-5-3-2-4-6-7/h4-9,11,17H,1-3,10H2;2-6H2,1H3.
What are the key properties of 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine?
1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine has a molecular weight of 439.86 g/mol, XLogP of 7.48, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-(2,4-dichlorophenyl)piperidine;1-methylpiperidine is sourced from PubChem (CID 143508383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).