C30H31N5O4 — CID 143510361
(5R)-5-[(5-but-2-ynoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,4,5,6,7,7a-hexahydroindazol-5-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 143510361) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is (5R)-5-[(5-but-2-ynoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,4,5,6,7,7a-hexahydroindazol-5-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-but-2-ynoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,4,5,6,7,7a-hexahydroindazol-5-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510361 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | (5R)-5-[(5-but-2-ynoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-(2-methyl-1,4,5,6,7,7a-hexahydroindazol-5-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | CC#CCOc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(C4CCC5NN(C)C=C5C4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C30H31N5O4/c1-3-4-13-39-24-11-7-21-17-35(27(36)25(21)15-24)18-30(28(37)31-29(38)32-30)23-9-5-19(6-10-23)20-8-12-26-22(14-20)16-34(2)33-26/h5-7,9-11,15-16,20,26,33H,8,12-14,17-18H2,1-2H3,(H2,31,32,37,38)/t20?,26?,30-/m0/s1 |
| InChIKey | GMPMRQBJWHJEHW-GXJLEPMTSA-N |
| XLogP | 2.75 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|