C18H13N5O2 — CID 1435106
2-[(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile (PubChem CID 1435106) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile.
| Compound Name | 2-[(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 1435106 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[(10-methyl-3,4-dioxo-[1,2,4]triazino[4,3-a]benzimidazol-2-yl)methyl]benzonitrile |
| SMILES | Cn1c2ccccc2n2c(=O)c(=O)n(Cc3ccccc3C#N)nc12 |
| InChI | InChI=1S/C18H13N5O2/c1-21-14-8-4-5-9-15(14)23-17(25)16(24)22(20-18(21)23)11-13-7-3-2-6-12(13)10-19/h2-9H,11H2,1H3 |
| InChIKey | RKMULRKMOMARME-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|