About N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide
N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide (PubChem CID 143513162) has the molecular formula C10H20FN3
and a molecular weight of 201.29 g/mol. Its IUPAC name is N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide.
Molecular Properties
| Compound Name | N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide |
| PubChem CID | 143513162 |
| Molecular Formula | C10H20FN3 |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide |
| SMILES | C=CN(/C=N/CC)C(CCN)CCF |
| InChI | InChI=1S/C10H20FN3/c1-3-13-9-14(4-2)10(5-7-11)6-8-12/h4,9-10H,2-3,5-8,12H2,1H3/b13-9+ |
| InChIKey | MGNGBBGRKFYYOE-UKTHLTGXSA-N |
| XLogP | 1.56 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide?
The IUPAC name of N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide (CID 143513162) is N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide.
What is the SMILES notation for N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide?
The canonical SMILES for N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide is C=CN(/C=N/CC)C(CCN)CCF.
What is the InChIKey of N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide?
The InChIKey is MGNGBBGRKFYYOE-UKTHLTGXSA-N. The full InChI is InChI=1S/C10H20FN3/c1-3-13-9-14(4-2)10(5-7-11)6-8-12/h4,9-10H,2-3,5-8,12H2,1H3/b13-9+.
What are the key properties of N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide?
N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide has a molecular weight of 201.29 g/mol, XLogP of 1.56, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-5-fluoropentan-3-yl)-N-ethenyl-N'-ethylmethanimidamide is sourced from PubChem (CID 143513162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).