About N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane
N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane (PubChem CID 143187083) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane |
| PubChem CID | 143187083 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane |
| SMILES | C=CN(/C=N/C)CCCN.CCCC |
| InChI | InChI=1S/C7H15N3.C4H10/c1-3-10(7-9-2)6-4-5-8;1-3-4-2/h3,7H,1,4-6,8H2,2H3;3-4H2,1-2H3/b9-7+; |
| InChIKey | NRWVFVWAHUDAMM-BXTVWIJMSA-N |
| XLogP | 2.25 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane?
The IUPAC name of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane (CID 143187083) is N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane.
What is the SMILES notation for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane?
The canonical SMILES for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane is C=CN(/C=N/C)CCCN.CCCC.
What is the InChIKey of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane?
The InChIKey is NRWVFVWAHUDAMM-BXTVWIJMSA-N. The full InChI is InChI=1S/C7H15N3.C4H10/c1-3-10(7-9-2)6-4-5-8;1-3-4-2/h3,7H,1,4-6,8H2,2H3;3-4H2,1-2H3/b9-7+;.
What are the key properties of N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane?
N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane has a molecular weight of 199.34 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-N-ethenyl-N'-methylmethanimidamide;butane is sourced from PubChem (CID 143187083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).