C22H21N — CID 143515929
5-(3,5-dimethylphenyl)-6,11-dihydrocyclohepta[c]quinoline (PubChem CID 143515929) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is 5-(3,5-dimethylphenyl)-6,11-dihydrocyclohepta[c]quinoline.
| Compound Name | 5-(3,5-dimethylphenyl)-6,11-dihydrocyclohepta[c]quinoline |
|---|---|
| PubChem CID | 143515929 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5-(3,5-dimethylphenyl)-6,11-dihydrocyclohepta[c]quinoline |
| SMILES | Cc1cc(C)cc(N2CC3=C(CC=CC=C3)c3ccccc32)c1 |
| InChI | InChI=1S/C22H21N/c1-16-12-17(2)14-19(13-16)23-15-18-8-4-3-5-9-20(18)21-10-6-7-11-22(21)23/h3-8,10-14H,9,15H2,1-2H3 |
| InChIKey | XVBNWRPHHBNKOT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |