C11H9Cl2N3O2 — CID 143516405
[5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]methylcarbamic acid (PubChem CID 143516405) has the molecular formula C11H9Cl2N3O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]methylcarbamic acid.
| Compound Name | [5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 143516405 |
| Molecular Formula | C11H9Cl2N3O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-1H-imidazol-2-yl]methylcarbamic acid |
| SMILES | O=C(O)NCc1ncc(-c2ccc(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C11H9Cl2N3O2/c12-7-2-1-6(3-8(7)13)9-4-14-10(16-9)5-15-11(17)18/h1-4,15H,5H2,(H,14,16)(H,17,18) |
| InChIKey | MTCWYUBYTYEJGQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |