C13H14FN3S — CID 143516885
5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine (PubChem CID 143516885) has the molecular formula C13H14FN3S and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine.
| Compound Name | 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 143516885 |
| Molecular Formula | C13H14FN3S |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-[(2-amino-4-fluorophenyl)sulfanylmethyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(CSc2ccc(F)cc2N)cn1 |
| InChI | InChI=1S/C13H14FN3S/c1-16-13-5-2-9(7-17-13)8-18-12-4-3-10(14)6-11(12)15/h2-7H,8,15H2,1H3,(H,16,17) |
| InChIKey | JLUAZHAAPWNSKT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|