C21H33F3N2O2 — CID 143519471
ethane;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine;(3Z)-penta-1,3-diene (PubChem CID 143519471) has the molecular formula C21H33F3N2O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethane;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine;(3Z)-penta-1,3-diene.
| Compound Name | ethane;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 143519471 |
| Molecular Formula | C21H33F3N2O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | ethane;(3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]piperidin-3-amine;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.CC.COc1ccc(OC(F)(F)F)cc1CN[C@H]1CCCNC1 |
| InChI | InChI=1S/C14H19F3N2O2.C5H8.C2H6/c1-20-13-5-4-12(21-14(15,16)17)7-10(13)8-19-11-3-2-6-18-9-11;1-3-5-4-2;1-2/h4-5,7,11,18-19H,2-3,6,8-9H2,1H3;3-5H,1H2,2H3;1-2H3/b;5-4-;/t11-;;/m0../s1 |
| InChIKey | QXTIUHLKYGVTSH-CTNRIFSZSA-N |
| XLogP | 5.21 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|