C23H31NO3 — CID 143519648
2-(2-methoxyphenyl)acetaldehyde;1-methyl-4-(2-phenoxyethyl)piperidine (PubChem CID 143519648) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)acetaldehyde;1-methyl-4-(2-phenoxyethyl)piperidine.
| Compound Name | 2-(2-methoxyphenyl)acetaldehyde;1-methyl-4-(2-phenoxyethyl)piperidine |
|---|---|
| PubChem CID | 143519648 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 2-(2-methoxyphenyl)acetaldehyde;1-methyl-4-(2-phenoxyethyl)piperidine |
| SMILES | CN1CCC(CCOc2ccccc2)CC1.COc1ccccc1CC=O |
| InChI | InChI=1S/C14H21NO.C9H10O2/c1-15-10-7-13(8-11-15)9-12-16-14-5-3-2-4-6-14;1-11-9-5-3-2-4-8(9)6-7-10/h2-6,13H,7-12H2,1H3;2-5,7H,6H2,1H3 |
| InChIKey | GBRCQCHADAJRQV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|