C25H26N8 — CID 143520950
N-(4-piperidin-1-ylphenyl)-4-[4-(2-pyrimidin-4-ylhydrazinyl)phenyl]pyrimidin-2-amine (PubChem CID 143520950) has the molecular formula C25H26N8 and a molecular weight of 438.54 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-4-[4-(2-pyrimidin-4-ylhydrazinyl)phenyl]pyrimidin-2-amine.
| Compound Name | N-(4-piperidin-1-ylphenyl)-4-[4-(2-pyrimidin-4-ylhydrazinyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143520950 |
| Molecular Formula | C25H26N8 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-4-[4-(2-pyrimidin-4-ylhydrazinyl)phenyl]pyrimidin-2-amine |
| SMILES | c1cc(NNc2ccc(-c3ccnc(Nc4ccc(N5CCCCC5)cc4)n3)cc2)ncn1 |
| InChI | InChI=1S/C25H26N8/c1-2-16-33(17-3-1)22-10-8-20(9-11-22)29-25-27-15-12-23(30-25)19-4-6-21(7-5-19)31-32-24-13-14-26-18-28-24/h4-15,18,31H,1-3,16-17H2,(H,26,28,32)(H,27,29,30) |
| InChIKey | GBWYOEUQGWQTIA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|