C16H22FNO5 — CID 143522261
3-(3,4-dihydroxyphenyl)-2-[(2-ethyl-2-fluoropentanoyl)amino]propanoic acid (PubChem CID 143522261) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-[(2-ethyl-2-fluoropentanoyl)amino]propanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-[(2-ethyl-2-fluoropentanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 143522261 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-[(2-ethyl-2-fluoropentanoyl)amino]propanoic acid |
| SMILES | CCCC(F)(CC)C(=O)NC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C16H22FNO5/c1-3-7-16(17,4-2)15(23)18-11(14(21)22)8-10-5-6-12(19)13(20)9-10/h5-6,9,11,19-20H,3-4,7-8H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | RTDQKIBQZSAAPX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|