C26H34ClN3O — CID 143524714
acetylene;1-[4-(4-chlorophenyl)-3,3,4-trimethylpiperidin-1-yl]-3-methyl-2-(pyridin-3-ylamino)butan-1-one (PubChem CID 143524714) has the molecular formula C26H34ClN3O and a molecular weight of 440.03 g/mol. Its IUPAC name is acetylene;1-[4-(4-chlorophenyl)-3,3,4-trimethylpiperidin-1-yl]-3-methyl-2-(pyridin-3-ylamino)butan-1-one.
| Compound Name | acetylene;1-[4-(4-chlorophenyl)-3,3,4-trimethylpiperidin-1-yl]-3-methyl-2-(pyridin-3-ylamino)butan-1-one |
|---|---|
| PubChem CID | 143524714 |
| Molecular Formula | C26H34ClN3O |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | acetylene;1-[4-(4-chlorophenyl)-3,3,4-trimethylpiperidin-1-yl]-3-methyl-2-(pyridin-3-ylamino)butan-1-one |
| SMILES | C#C.CC(C)C(Nc1cccnc1)C(=O)N1CCC(C)(c2ccc(Cl)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C24H32ClN3O.C2H2/c1-17(2)21(27-20-7-6-13-26-15-20)22(29)28-14-12-24(5,23(3,4)16-28)18-8-10-19(25)11-9-18;1-2/h6-11,13,15,17,21,27H,12,14,16H2,1-5H3;1-2H |
| InChIKey | ZTJZMJRZXJUZMG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|