C24H21F2NO — CID 143527516
(2R)-6-(3-fluorophenyl)-2-(3-fluoro-4-phenylphenyl)-4-iminohexan-3-one (PubChem CID 143527516) has the molecular formula C24H21F2NO and a molecular weight of 377.43 g/mol. Its IUPAC name is (2R)-6-(3-fluorophenyl)-2-(3-fluoro-4-phenylphenyl)-4-iminohexan-3-one.
| Compound Name | (2R)-6-(3-fluorophenyl)-2-(3-fluoro-4-phenylphenyl)-4-iminohexan-3-one |
|---|---|
| PubChem CID | 143527516 |
| Molecular Formula | C24H21F2NO |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2R)-6-(3-fluorophenyl)-2-(3-fluoro-4-phenylphenyl)-4-iminohexan-3-one |
| SMILES | [H]/N=C(\CCc1cccc(F)c1)C(=O)[C@H](C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C24H21F2NO/c1-16(24(28)23(27)13-10-17-6-5-9-20(25)14-17)19-11-12-21(22(26)15-19)18-7-3-2-4-8-18/h2-9,11-12,14-16,27H,10,13H2,1H3/b27-23+/t16-/m1/s1 |
| InChIKey | AQSKXMVBPGLXGP-ZBCNTGKUSA-N |
| XLogP | 5.96 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|