C28H33FN4O4 — CID 143528895
(10R,15S)-4-(1-fluoroethoxy)-10-(3-hydroxyphenyl)-15-methyl-13-[3-(propylamino)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione (PubChem CID 143528895) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is (10R,15S)-4-(1-fluoroethoxy)-10-(3-hydroxyphenyl)-15-methyl-13-[3-(propylamino)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione.
| Compound Name | (10R,15S)-4-(1-fluoroethoxy)-10-(3-hydroxyphenyl)-15-methyl-13-[3-(propylamino)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
|---|---|
| PubChem CID | 143528895 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | (10R,15S)-4-(1-fluoroethoxy)-10-(3-hydroxyphenyl)-15-methyl-13-[3-(propylamino)propyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5-tetraene-12,14-dione |
| SMILES | CCCNCCCN1C(=O)N2[C@H](c3cccc(O)c3)c3[nH]c4ccc(OC(C)F)cc4c3C[C@@]2(C)C1=O |
| InChI | InChI=1S/C28H33FN4O4/c1-4-11-30-12-6-13-32-26(35)28(3)16-22-21-15-20(37-17(2)29)9-10-23(21)31-24(22)25(33(28)27(32)36)18-7-5-8-19(34)14-18/h5,7-10,14-15,17,25,30-31,34H,4,6,11-13,16H2,1-3H3/t17?,25-,28+/m1/s1 |
| InChIKey | FCXZQWJCYXGJOW-ZMWAJFJOSA-N |
| XLogP | 4.63 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|