C13H22N2O — CID 143529170
N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide (PubChem CID 143529170) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 143529170 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-[(Z)-3-(ethenyliminomethyl)pent-3-enyl]-2,2-dimethylpropanamide |
| SMILES | C=C/N=C/C(=C\C)CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O/c1-6-11(10-14-7-2)8-9-15-12(16)13(3,4)5/h6-7,10H,2,8-9H2,1,3-5H3,(H,15,16)/b11-6-,14-10+ |
| InChIKey | RILBDRCUEMUGID-HNPFEXMKSA-N |
| XLogP | 2.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|