C17H24N4 — CID 143529359
ethane;N'-methyl-N-[1-(1-methylpyrazol-4-yl)ethenyl]cyclohepta-1,4,6-triene-1-carboximidamide (PubChem CID 143529359) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is ethane;N'-methyl-N-[1-(1-methylpyrazol-4-yl)ethenyl]cyclohepta-1,4,6-triene-1-carboximidamide.
| Compound Name | ethane;N'-methyl-N-[1-(1-methylpyrazol-4-yl)ethenyl]cyclohepta-1,4,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 143529359 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | ethane;N'-methyl-N-[1-(1-methylpyrazol-4-yl)ethenyl]cyclohepta-1,4,6-triene-1-carboximidamide |
| SMILES | C=C(N/C(=N\C)C1=CCC=CC=C1)c1cnn(C)c1.CC |
| InChI | InChI=1S/C15H18N4.C2H6/c1-12(14-10-17-19(3)11-14)18-15(16-2)13-8-6-4-5-7-9-13;1-2/h4-6,8-11H,1,7H2,2-3H3,(H,16,18);1-2H3 |
| InChIKey | PZVYUSIWLQQGGB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|