C28H27ClF6N6O4 — CID 143529745
4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-[2-(dimethylamino)ethyl]-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 143529745) has the molecular formula C28H27ClF6N6O4 and a molecular weight of 661.00 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-[2-(dimethylamino)ethyl]-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-[2-(dimethylamino)ethyl]-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 143529745 |
| Molecular Formula | C28H27ClF6N6O4 |
| Molecular Weight | 661.00 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-[2-(dimethylamino)ethyl]-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCNC(=O)C1=Cc2c(ncnc2Nc2ccc(Oc3cccc(C(F)(F)F)c3)c(Cl)c2)NCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26ClF3N6O2.C2HF3O2/c1-36(2)11-10-32-25(37)16-8-9-31-23-20(12-16)24(34-15-33-23)35-18-6-7-22(21(27)14-18)38-19-5-3-4-17(13-19)26(28,29)30;3-2(4,5)1(6)7/h3-7,12-15H,8-11H2,1-2H3,(H,32,37)(H2,31,33,34,35);(H,6,7) |
| InChIKey | MXGAPIQSCPACEM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.00 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |