C29H22ClF6N5O5 — CID 86645428
4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-(furan-2-ylmethyl)-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 86645428) has the molecular formula C29H22ClF6N5O5 and a molecular weight of 669.97 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-(furan-2-ylmethyl)-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-(furan-2-ylmethyl)-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86645428 |
| Molecular Formula | C29H22ClF6N5O5 |
| Molecular Weight | 669.97 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | 4-[3-chloro-4-[3-(trifluoromethyl)phenoxy]anilino]-N-(furan-2-ylmethyl)-8,9-dihydro-7H-pyrimido[4,5-b]azepine-6-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1ccco1)C1=Cc2c(ncnc2Nc2ccc(Oc3cccc(C(F)(F)F)c3)c(Cl)c2)NCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H21ClF3N5O3.C2HF3O2/c28-22-13-18(6-7-23(22)39-19-4-1-3-17(12-19)27(29,30)31)36-25-21-11-16(8-9-32-24(21)34-15-35-25)26(37)33-14-20-5-2-10-38-20;3-2(4,5)1(6)7/h1-7,10-13,15H,8-9,14H2,(H,33,37)(H2,32,34,35,36);(H,6,7) |
| InChIKey | DIQPADVKTMRWDQ-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.97 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |