C21H23FN4O5 — CID 143532122
1-(4-fluoro-3-methoxyphenyl)-4-methylpiperazine;2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide (PubChem CID 143532122) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is 1-(4-fluoro-3-methoxyphenyl)-4-methylpiperazine;2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide.
| Compound Name | 1-(4-fluoro-3-methoxyphenyl)-4-methylpiperazine;2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
|---|---|
| PubChem CID | 143532122 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-(4-fluoro-3-methoxyphenyl)-4-methylpiperazine;2-oxo-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1F.O=CC(=O)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H17FN2O.C9H6N2O4/c1-14-5-7-15(8-6-14)10-3-4-11(13)12(9-10)16-2;12-4-8(13)10-5-1-2-6-7(3-5)15-9(14)11-6/h3-4,9H,5-8H2,1-2H3;1-4H,(H,10,13)(H,11,14) |
| InChIKey | CHIURDPETLLXQF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|