C15H24OS — CID 143533218
7,7-dimethyl-2-methylidene-3,4-dihydro-1H-cyclohepta[c]thiopyran 2-oxide;ethane (PubChem CID 143533218) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 7,7-dimethyl-2-methylidene-3,4-dihydro-1H-cyclohepta[c]thiopyran 2-oxide;ethane.
| Compound Name | 7,7-dimethyl-2-methylidene-3,4-dihydro-1H-cyclohepta[c]thiopyran 2-oxide;ethane |
|---|---|
| PubChem CID | 143533218 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 7,7-dimethyl-2-methylidene-3,4-dihydro-1H-cyclohepta[c]thiopyran 2-oxide;ethane |
| SMILES | C=S1(=O)CCC2=C(C=CC(C)(C)C=C2)C1.CC |
| InChI | InChI=1S/C13H18OS.C2H6/c1-13(2)7-4-11-6-9-15(3,14)10-12(11)5-8-13;1-2/h4-5,7-8H,3,6,9-10H2,1-2H3;1-2H3 |
| InChIKey | GXWHAURRDKKLGW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|