C15H20FN3OS — CID 143533976
N-ethyl-5-[5-(fluoromethyl)-1-methylpyrazol-3-yl]-N-propylthiophene-2-carboxamide (PubChem CID 143533976) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is N-ethyl-5-[5-(fluoromethyl)-1-methylpyrazol-3-yl]-N-propylthiophene-2-carboxamide.
| Compound Name | N-ethyl-5-[5-(fluoromethyl)-1-methylpyrazol-3-yl]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143533976 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-ethyl-5-[5-(fluoromethyl)-1-methylpyrazol-3-yl]-N-propylthiophene-2-carboxamide |
| SMILES | CCCN(CC)C(=O)c1ccc(-c2cc(CF)n(C)n2)s1 |
| InChI | InChI=1S/C15H20FN3OS/c1-4-8-19(5-2)15(20)14-7-6-13(21-14)12-9-11(10-16)18(3)17-12/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | QFNIEHBMWPKDCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |