C23H25NO2S — CID 46082678
5-(4-phenoxyphenyl)-N,N-dipropylthiophene-2-carboxamide (PubChem CID 46082678) has the molecular formula C23H25NO2S and a molecular weight of 379.53 g/mol. Its IUPAC name is 5-(4-phenoxyphenyl)-N,N-dipropylthiophene-2-carboxamide.
| Compound Name | 5-(4-phenoxyphenyl)-N,N-dipropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082678 |
| Molecular Formula | C23H25NO2S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 5-(4-phenoxyphenyl)-N,N-dipropylthiophene-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccc(-c2ccc(Oc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C23H25NO2S/c1-3-16-24(17-4-2)23(25)22-15-14-21(27-22)18-10-12-20(13-11-18)26-19-8-6-5-7-9-19/h5-15H,3-4,16-17H2,1-2H3 |
| InChIKey | GUOXUQKYDLRXOG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |