C22H21NO2S — CID 46082814
(2-methylpyrrolidin-1-yl)-[5-(4-phenoxyphenyl)thiophen-2-yl]methanone (PubChem CID 46082814) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is (2-methylpyrrolidin-1-yl)-[5-(4-phenoxyphenyl)thiophen-2-yl]methanone.
| Compound Name | (2-methylpyrrolidin-1-yl)-[5-(4-phenoxyphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 46082814 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | (2-methylpyrrolidin-1-yl)-[5-(4-phenoxyphenyl)thiophen-2-yl]methanone |
| SMILES | CC1CCCN1C(=O)c1ccc(-c2ccc(Oc3ccccc3)cc2)s1 |
| InChI | InChI=1S/C22H21NO2S/c1-16-6-5-15-23(16)22(24)21-14-13-20(26-21)17-9-11-19(12-10-17)25-18-7-3-2-4-8-18/h2-4,7-14,16H,5-6,15H2,1H3 |
| InChIKey | GVLRQZHFSWQWFN-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |