C27H25NO2S — CID 46082653
N,N-dibenzyl-5-(4-ethoxyphenyl)thiophene-2-carboxamide (PubChem CID 46082653) has the molecular formula C27H25NO2S and a molecular weight of 427.57 g/mol. Its IUPAC name is N,N-dibenzyl-5-(4-ethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N,N-dibenzyl-5-(4-ethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082653 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N,N-dibenzyl-5-(4-ethoxyphenyl)thiophene-2-carboxamide |
| SMILES | CCOc1ccc(-c2ccc(C(=O)N(Cc3ccccc3)Cc3ccccc3)s2)cc1 |
| InChI | InChI=1S/C27H25NO2S/c1-2-30-24-15-13-23(14-16-24)25-17-18-26(31-25)27(29)28(19-21-9-5-3-6-10-21)20-22-11-7-4-8-12-22/h3-18H,2,19-20H2,1H3 |
| InChIKey | BWRADUYKADAWBK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |