C17H17F2NO4S — CID 119173095
4-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]-methylamino]butanoic acid (PubChem CID 119173095) has the molecular formula C17H17F2NO4S and a molecular weight of 369.39 g/mol. Its IUPAC name is 4-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]-methylamino]butanoic acid.
| Compound Name | 4-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119173095 |
| Molecular Formula | C17H17F2NO4S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 4-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)c1ccc(-c2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C17H17F2NO4S/c1-20(10-2-3-15(21)22)16(23)14-9-8-13(25-14)11-4-6-12(7-5-11)24-17(18)19/h4-9,17H,2-3,10H2,1H3,(H,21,22) |
| InChIKey | NRCCEXUCJSYKNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |