C16H15F2NO4S — CID 119221199
3-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]amino]butanoic acid (PubChem CID 119221199) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is 3-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119221199 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 3-[[5-[4-(difluoromethoxy)phenyl]thiophene-2-carbonyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1ccc(-c2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C16H15F2NO4S/c1-9(8-14(20)21)19-15(22)13-7-6-12(24-13)10-2-4-11(5-3-10)23-16(17)18/h2-7,9,16H,8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | QRQICHXIVBKICY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |