C12H15F2NO4S — CID 119173000
4-[[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]-methylamino]butanoic acid (PubChem CID 119173000) has the molecular formula C12H15F2NO4S and a molecular weight of 307.32 g/mol. Its IUPAC name is 4-[[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]-methylamino]butanoic acid.
| Compound Name | 4-[[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 119173000 |
| Molecular Formula | C12H15F2NO4S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[[3-(difluoromethoxy)-5-methylthiophene-2-carbonyl]-methylamino]butanoic acid |
| SMILES | Cc1cc(OC(F)F)c(C(=O)N(C)CCCC(=O)O)s1 |
| InChI | InChI=1S/C12H15F2NO4S/c1-7-6-8(19-12(13)14)10(20-7)11(18)15(2)5-3-4-9(16)17/h6,12H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | YMFUXYNHBYPKPT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |