C18H12Cl2F3N3O — CID 143534160
3-[1-benzyl-3-(trifluoromethyl)pyrazol-5-yl]-N,N-dichlorobenzamide (PubChem CID 143534160) has the molecular formula C18H12Cl2F3N3O and a molecular weight of 414.21 g/mol. Its IUPAC name is 3-[1-benzyl-3-(trifluoromethyl)pyrazol-5-yl]-N,N-dichlorobenzamide.
| Compound Name | 3-[1-benzyl-3-(trifluoromethyl)pyrazol-5-yl]-N,N-dichlorobenzamide |
|---|---|
| PubChem CID | 143534160 |
| Molecular Formula | C18H12Cl2F3N3O |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 3-[1-benzyl-3-(trifluoromethyl)pyrazol-5-yl]-N,N-dichlorobenzamide |
| SMILES | O=C(c1cccc(-c2cc(C(F)(F)F)nn2Cc2ccccc2)c1)N(Cl)Cl |
| InChI | InChI=1S/C18H12Cl2F3N3O/c19-26(20)17(27)14-8-4-7-13(9-14)15-10-16(18(21,22)23)24-25(15)11-12-5-2-1-3-6-12/h1-10H,11H2 |
| InChIKey | LKVSMLGGVYSSOE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|