C40H40N4O8 — CID 143535451
2-[3-[1-[2-[3-(2-amino-5-nitrophenoxy)propoxy]-6-methoxynaphthalen-1-yl]-6-methoxynaphthalen-2-yl]oxypropoxy]benzene-1,4-diamine (PubChem CID 143535451) has the molecular formula C40H40N4O8 and a molecular weight of 704.78 g/mol. Its IUPAC name is 2-[3-[1-[2-[3-(2-amino-5-nitrophenoxy)propoxy]-6-methoxynaphthalen-1-yl]-6-methoxynaphthalen-2-yl]oxypropoxy]benzene-1,4-diamine.
| Compound Name | 2-[3-[1-[2-[3-(2-amino-5-nitrophenoxy)propoxy]-6-methoxynaphthalen-1-yl]-6-methoxynaphthalen-2-yl]oxypropoxy]benzene-1,4-diamine |
|---|---|
| PubChem CID | 143535451 |
| Molecular Formula | C40H40N4O8 |
| Molecular Weight | 704.78 g/mol |
| Exact Mass | 704.28 |
| IUPAC Name | 2-[3-[1-[2-[3-(2-amino-5-nitrophenoxy)propoxy]-6-methoxynaphthalen-1-yl]-6-methoxynaphthalen-2-yl]oxypropoxy]benzene-1,4-diamine |
| SMILES | COc1ccc2c(-c3c(OCCCOc4cc([N+](=O)[O-])ccc4N)ccc4cc(OC)ccc34)c(OCCCOc3cc(N)ccc3N)ccc2c1 |
| InChI | InChI=1S/C40H40N4O8/c1-47-29-9-11-31-25(21-29)5-15-35(49-17-3-19-51-37-23-27(41)7-13-33(37)42)39(31)40-32-12-10-30(48-2)22-26(32)6-16-36(40)50-18-4-20-52-38-24-28(44(45)46)8-14-34(38)43/h5-16,21-24H,3-4,17-20,41-43H2,1-2H3 |
| InChIKey | OMAMMTBSCBAWBM-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 176.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.78 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|