C21H27N3O3S — CID 143538847
4-(2,4-dimethylphenyl)-7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidine-5-carboxylic acid (PubChem CID 143538847) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidine-5-carboxylic acid.
| Compound Name | 4-(2,4-dimethylphenyl)-7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 143538847 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-7-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]pyrrolo[2,3-d]pyrimidine-5-carboxylic acid |
| SMILES | Cc1ccc(-c2ncnc3c2c(C(=O)O)cn3COCCS(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-14-6-7-16(15(2)10-14)19-18-17(21(25)26)11-24(20(18)23-12-22-19)13-27-8-9-28(3,4)5/h6-7,10-12H,8-9,13H2,1-5H3,(H,25,26) |
| InChIKey | NUWUVRKQUOZGBK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|