About ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane
ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane (PubChem CID 143538925) has the molecular formula C24H43N3
and a molecular weight of 373.63 g/mol. Its IUPAC name is ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane.
Molecular Properties
| Compound Name | ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane |
| PubChem CID | 143538925 |
| Molecular Formula | C24H43N3 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.35 |
| IUPAC Name | ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane |
| SMILES | C=C.C=CC/C(=C\C)C/N=c1\ccccn1CN.CCCCCCCCC |
| InChI | InChI=1S/C13H19N3.C9H20.C2H4/c1-3-7-12(4-2)10-15-13-8-5-6-9-16(13)11-14;1-3-5-7-9-8-6-4-2;1-2/h3-6,8-9H,1,7,10-11,14H2,2H3;3-9H2,1-2H3;1-2H2/b12-4+,15-13+;; |
| InChIKey | GVKQYASKVGWUIP-QXFPFAPKSA-N |
| XLogP | 6.39 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane?
The IUPAC name of ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane (CID 143538925) is ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane.
What is the SMILES notation for ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane?
The canonical SMILES for ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane is C=C.C=CC/C(=C\C)C/N=c1\ccccn1CN.CCCCCCCCC.
What is the InChIKey of ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane?
The InChIKey is GVKQYASKVGWUIP-QXFPFAPKSA-N. The full InChI is InChI=1S/C13H19N3.C9H20.C2H4/c1-3-7-12(4-2)10-15-13-8-5-6-9-16(13)11-14;1-3-5-7-9-8-6-4-2;1-2/h3-6,8-9H,1,7,10-11,14H2,2H3;3-9H2,1-2H3;1-2H2/b12-4+,15-13+;;.
What are the key properties of ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane?
ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane has a molecular weight of 373.63 g/mol, XLogP of 6.39, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine;nonane is sourced from PubChem (CID 143538925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).