C13H19N3 — CID 143538926
[2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine (PubChem CID 143538926) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is [2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine.
| Compound Name | [2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine |
|---|---|
| PubChem CID | 143538926 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | [2-[(2E)-2-ethylidenepent-4-enyl]imino-1-pyridinyl]methanamine |
| SMILES | C=CC/C(=C\C)C/N=c1\ccccn1CN |
| InChI | InChI=1S/C13H19N3/c1-3-7-12(4-2)10-15-13-8-5-6-9-16(13)11-14/h3-6,8-9H,1,7,10-11,14H2,2H3/b12-4+,15-13+ |
| InChIKey | LBDNCJVHWHCKGL-DEILCNCOSA-N |
| XLogP | 1.83 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|