C11H12N2 — CID 143869398
N-methyl-6H-cyclohepta[c]pyridin-1-amine (PubChem CID 143869398) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is N-methyl-6H-cyclohepta[c]pyridin-1-amine.
| Compound Name | N-methyl-6H-cyclohepta[c]pyridin-1-amine |
|---|---|
| PubChem CID | 143869398 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N-methyl-6H-cyclohepta[c]pyridin-1-amine |
| SMILES | CNc1nccc2c1=CC=CCC=2 |
| InChI | InChI=1S/C11H12N2/c1-12-11-10-6-4-2-3-5-9(10)7-8-13-11/h2,4-8H,3H2,1H3,(H,12,13) |
| InChIKey | IERKCMDDJWRMIM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |