C17H27N3 — CID 142947862
ethane;(2Z,4E)-4-[(E)-2-(5-methyl-2-methylimino-1-pyridinyl)ethenyl]hexa-2,4-dien-1-amine (PubChem CID 142947862) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is ethane;(2Z,4E)-4-[(E)-2-(5-methyl-2-methylimino-1-pyridinyl)ethenyl]hexa-2,4-dien-1-amine.
| Compound Name | ethane;(2Z,4E)-4-[(E)-2-(5-methyl-2-methylimino-1-pyridinyl)ethenyl]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142947862 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | ethane;(2Z,4E)-4-[(E)-2-(5-methyl-2-methylimino-1-pyridinyl)ethenyl]hexa-2,4-dien-1-amine |
| SMILES | C/C=C(\C=C/CN)/C=C/n1cc(C)cc/c1=N\C.CC |
| InChI | InChI=1S/C15H21N3.C2H6/c1-4-14(6-5-10-16)9-11-18-12-13(2)7-8-15(18)17-3;1-2/h4-9,11-12H,10,16H2,1-3H3;1-2H3/b6-5-,11-9+,14-4+,17-15+; |
| InChIKey | PXDJSHHEECEDGT-GIWOPUBSSA-N |
| XLogP | 3.29 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|