C25H39N5O — CID 143540927
1-(4-cyclobutylpiperazin-1-yl)-2-[6-[(methylideneamino)-[(Z)-prop-1-enyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethane (PubChem CID 143540927) has the molecular formula C25H39N5O and a molecular weight of 425.62 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[6-[(methylideneamino)-[(Z)-prop-1-enyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethane.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[6-[(methylideneamino)-[(Z)-prop-1-enyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethane |
|---|---|
| PubChem CID | 143540927 |
| Molecular Formula | C25H39N5O |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.32 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[6-[(methylideneamino)-[(Z)-prop-1-enyl]amino]-3,4-dihydro-1H-isoquinolin-2-yl]ethanone;ethane |
| SMILES | C=NN(/C=C\C)c1ccc2c(c1)CCN(CC(=O)N1CCN(C3CCC3)CC1)C2.CC |
| InChI | InChI=1S/C23H33N5O.C2H6/c1-3-10-28(24-2)22-8-7-20-17-25(11-9-19(20)16-22)18-23(29)27-14-12-26(13-15-27)21-5-4-6-21;1-2/h3,7-8,10,16,21H,2,4-6,9,11-15,17-18H2,1H3;1-2H3/b10-3-; |
| InChIKey | DCEUIIIDOJNULX-HVHUWTQGSA-N |
| XLogP | 3.72 |
| TPSA | 42.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|