C17H27NO4 — CID 143541163
ethane;3-(6-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid (PubChem CID 143541163) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethane;3-(6-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid.
| Compound Name | ethane;3-(6-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 143541163 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | ethane;3-(6-methoxy-2-oxo-3,4-dihydroquinolin-1-yl)propanoic acid |
| SMILES | CC.CC.COc1ccc2c(c1)CCC(=O)N2CCC(=O)O |
| InChI | InChI=1S/C13H15NO4.2C2H6/c1-18-10-3-4-11-9(8-10)2-5-12(15)14(11)7-6-13(16)17;2*1-2/h3-4,8H,2,5-7H2,1H3,(H,16,17);2*1-2H3 |
| InChIKey | XYHPXSLQEHBAGS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |