C24H23FN6O4 — CID 143541629
8-amino-6-[3-(benzimidazol-1-yl)propylamino]-7-fluoro-2,2-dimethyl-N,10-dioxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide (PubChem CID 143541629) has the molecular formula C24H23FN6O4 and a molecular weight of 478.48 g/mol. Its IUPAC name is 8-amino-6-[3-(benzimidazol-1-yl)propylamino]-7-fluoro-2,2-dimethyl-N,10-dioxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide.
| Compound Name | 8-amino-6-[3-(benzimidazol-1-yl)propylamino]-7-fluoro-2,2-dimethyl-N,10-dioxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 143541629 |
| Molecular Formula | C24H23FN6O4 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 8-amino-6-[3-(benzimidazol-1-yl)propylamino]-7-fluoro-2,2-dimethyl-N,10-dioxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxamide |
| SMILES | CC1(C)COc2c(NCCCn3cnc4ccccc43)c(F)c(N)c3c(=O)c(C(=O)N=O)cn1c23 |
| InChI | InChI=1S/C24H23FN6O4/c1-24(2)11-35-22-19(27-8-5-9-30-12-28-14-6-3-4-7-15(14)30)17(25)18(26)16-20(22)31(24)10-13(21(16)32)23(33)29-34/h3-4,6-7,10,12,27H,5,8-9,11,26H2,1-2H3 |
| InChIKey | JVRQDHMZVYEJPB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|