C13H14ClNO — CID 143541732
4-(3-chloro-4-ethylphenyl)-3,5-dimethyl-1,2-oxazole (PubChem CID 143541732) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 4-(3-chloro-4-ethylphenyl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(3-chloro-4-ethylphenyl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 143541732 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(3-chloro-4-ethylphenyl)-3,5-dimethyl-1,2-oxazole |
| SMILES | CCc1ccc(-c2c(C)noc2C)cc1Cl |
| InChI | InChI=1S/C13H14ClNO/c1-4-10-5-6-11(7-12(10)14)13-8(2)15-16-9(13)3/h5-7H,4H2,1-3H3 |
| InChIKey | MOPKFABOURFVDF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |