C14H13BN2S — CID 143542167
4-(7-methylthieno[3,2-b]pyridin-2-yl)-3,6-dihydro-2H-borinine-1-carbonitrile (PubChem CID 143542167) has the molecular formula C14H13BN2S and a molecular weight of 252.15 g/mol. Its IUPAC name is 4-(7-methylthieno[3,2-b]pyridin-2-yl)-3,6-dihydro-2H-borinine-1-carbonitrile.
| Compound Name | 4-(7-methylthieno[3,2-b]pyridin-2-yl)-3,6-dihydro-2H-borinine-1-carbonitrile |
|---|---|
| PubChem CID | 143542167 |
| Molecular Formula | C14H13BN2S |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-(7-methylthieno[3,2-b]pyridin-2-yl)-3,6-dihydro-2H-borinine-1-carbonitrile |
| SMILES | Cc1ccnc2cc(C3=CCB(C#N)CC3)sc12 |
| InChI | InChI=1S/C14H13BN2S/c1-10-4-7-17-12-8-13(18-14(10)12)11-2-5-15(9-16)6-3-11/h2,4,7-8H,3,5-6H2,1H3 |
| InChIKey | NHWMNUUYVDMPJR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|