C9H9NO2S — CID 23401181
2-(hydroperoxymethyl)-7-methylthieno[3,2-b]pyridine (PubChem CID 23401181) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(hydroperoxymethyl)-7-methylthieno[3,2-b]pyridine.
| Compound Name | 2-(hydroperoxymethyl)-7-methylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 23401181 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-(hydroperoxymethyl)-7-methylthieno[3,2-b]pyridine |
| SMILES | Cc1ccnc2cc(COO)sc12 |
| InChI | InChI=1S/C9H9NO2S/c1-6-2-3-10-8-4-7(5-12-11)13-9(6)8/h2-4,11H,5H2,1H3 |
| InChIKey | KPIQOKLQXJKKFM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|