About cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate
cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate (PubChem CID 155570685) has the molecular formula C16H18N2O3S
and a molecular weight of 318.40 g/mol. Its IUPAC name is cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate |
| PubChem CID | 155570685 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate |
| SMILES | Cc1ccnc2cc(C(=O)NCCC(=O)OCC3CC3)sc12 |
| InChI | InChI=1S/C16H18N2O3S/c1-10-4-6-17-12-8-13(22-15(10)12)16(20)18-7-5-14(19)21-9-11-2-3-11/h4,6,8,11H,2-3,5,7,9H2,1H3,(H,18,20) |
| InChIKey | ASGOQQYPHXRBSK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate?
The IUPAC name of cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate (CID 155570685) is cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate.
What is the SMILES notation for cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate?
The canonical SMILES for cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate is Cc1ccnc2cc(C(=O)NCCC(=O)OCC3CC3)sc12.
What is the InChIKey of cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate?
The InChIKey is ASGOQQYPHXRBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3S/c1-10-4-6-17-12-8-13(22-15(10)12)16(20)18-7-5-14(19)21-9-11-2-3-11/h4,6,8,11H,2-3,5,7,9H2,1H3,(H,18,20).
What are the key properties of cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate?
cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate has a molecular weight of 318.40 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 3-[(7-methylthieno[3,2-b]pyridine-2-carbonyl)amino]propanoate is sourced from PubChem (CID 155570685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).