C25H31NO2 — CID 143542999
1-[4-(cyclohexa-1,5-dien-1-ylmethoxy)-3-methylphenyl]-2-[2-(3-methylphenyl)ethylamino]ethanol (PubChem CID 143542999) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[4-(cyclohexa-1,5-dien-1-ylmethoxy)-3-methylphenyl]-2-[2-(3-methylphenyl)ethylamino]ethanol.
| Compound Name | 1-[4-(cyclohexa-1,5-dien-1-ylmethoxy)-3-methylphenyl]-2-[2-(3-methylphenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 143542999 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 1-[4-(cyclohexa-1,5-dien-1-ylmethoxy)-3-methylphenyl]-2-[2-(3-methylphenyl)ethylamino]ethanol |
| SMILES | Cc1cccc(CCNCC(O)c2ccc(OCC3=CCCC=C3)c(C)c2)c1 |
| InChI | InChI=1S/C25H31NO2/c1-19-7-6-10-21(15-19)13-14-26-17-24(27)23-11-12-25(20(2)16-23)28-18-22-8-4-3-5-9-22/h4,6-12,15-16,24,26-27H,3,5,13-14,17-18H2,1-2H3 |
| InChIKey | IVVHMTNRJGOJNB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|