C24H35FNO4P — CID 143544590
[[(E)-but-2-en-2-yl]oxy-fluoromethyl]phosphane;tert-butyl 2-[4-(3-methyl-4-methylidene-2-oxopyrrolidin-1-yl)phenyl]propanoate (PubChem CID 143544590) has the molecular formula C24H35FNO4P and a molecular weight of 451.52 g/mol. Its IUPAC name is [[(E)-but-2-en-2-yl]oxy-fluoromethyl]phosphane;tert-butyl 2-[4-(3-methyl-4-methylidene-2-oxopyrrolidin-1-yl)phenyl]propanoate.
| Compound Name | [[(E)-but-2-en-2-yl]oxy-fluoromethyl]phosphane;tert-butyl 2-[4-(3-methyl-4-methylidene-2-oxopyrrolidin-1-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 143544590 |
| Molecular Formula | C24H35FNO4P |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [[(E)-but-2-en-2-yl]oxy-fluoromethyl]phosphane;tert-butyl 2-[4-(3-methyl-4-methylidene-2-oxopyrrolidin-1-yl)phenyl]propanoate |
| SMILES | C/C=C(\C)OC(F)P.C=C1CN(c2ccc(C(C)C(=O)OC(C)(C)C)cc2)C(=O)C1C |
| InChI | InChI=1S/C19H25NO3.C5H10FOP/c1-12-11-20(17(21)13(12)2)16-9-7-15(8-10-16)14(3)18(22)23-19(4,5)6;1-3-4(2)7-5(6)8/h7-10,13-14H,1,11H2,2-6H3;3,5H,8H2,1-2H3/b;4-3+ |
| InChIKey | HUCFKAHECPQVOQ-SCBDLNNBSA-N |
| XLogP | 5.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|