C28H29NO3 — CID 159897298
tert-butyl 2-[4-(5-benzyl-3-oxo-1H-isoindol-2-yl)phenyl]propanoate (PubChem CID 159897298) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl 2-[4-(5-benzyl-3-oxo-1H-isoindol-2-yl)phenyl]propanoate.
| Compound Name | tert-butyl 2-[4-(5-benzyl-3-oxo-1H-isoindol-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 159897298 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl 2-[4-(5-benzyl-3-oxo-1H-isoindol-2-yl)phenyl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)c1ccc(N2Cc3ccc(Cc4ccccc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C28H29NO3/c1-19(27(31)32-28(2,3)4)22-12-14-24(15-13-22)29-18-23-11-10-21(17-25(23)26(29)30)16-20-8-6-5-7-9-20/h5-15,17,19H,16,18H2,1-4H3 |
| InChIKey | NVMSQYNXEWFEKR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |