C28H31NO3 — CID 143544825
2-[4-[1-hydroxy-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]phenyl]-6-(4-methylphenyl)-3H-isoindol-1-one (PubChem CID 143544825) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[4-[1-hydroxy-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]phenyl]-6-(4-methylphenyl)-3H-isoindol-1-one.
| Compound Name | 2-[4-[1-hydroxy-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]phenyl]-6-(4-methylphenyl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143544825 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[4-[1-hydroxy-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]phenyl]-6-(4-methylphenyl)-3H-isoindol-1-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(c2ccc(C(C)C(O)OC(C)(C)C)cc2)C3)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-18-6-8-21(9-7-18)22-10-11-23-17-29(26(30)25(23)16-22)24-14-12-20(13-15-24)19(2)27(31)32-28(3,4)5/h6-16,19,27,31H,17H2,1-5H3 |
| InChIKey | GSXTVTYNEJLRPA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|